C12H17N3O4 — CID 67765806
tert-butyl N-[(3-amino-4-hydroxybenzoyl)amino]carbamate (PubChem CID 67765806) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is tert-butyl N-[(3-amino-4-hydroxybenzoyl)amino]carbamate.
| Compound Name | tert-butyl N-[(3-amino-4-hydroxybenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 67765806 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | tert-butyl N-[(3-amino-4-hydroxybenzoyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)c1ccc(O)c(N)c1 |
| InChI | InChI=1S/C12H17N3O4/c1-12(2,3)19-11(18)15-14-10(17)7-4-5-9(16)8(13)6-7/h4-6,16H,13H2,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | JXIUWJRJDILRGL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|