C13H15F3N2O3 — CID 11449558
tert-butyl N-[[4-(trifluoromethyl)benzoyl]amino]carbamate (PubChem CID 11449558) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is tert-butyl N-[[4-(trifluoromethyl)benzoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[4-(trifluoromethyl)benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 11449558 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | tert-butyl N-[[4-(trifluoromethyl)benzoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-12(2,3)21-11(20)18-17-10(19)8-4-6-9(7-5-8)13(14,15)16/h4-7H,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | OXCFIOICLTWCDH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|