C12H15F3N2O — CID 141237629
N'-tert-butyl-4-(trifluoromethyl)benzohydrazide (PubChem CID 141237629) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N'-tert-butyl-4-(trifluoromethyl)benzohydrazide.
| Compound Name | N'-tert-butyl-4-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 141237629 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N'-tert-butyl-4-(trifluoromethyl)benzohydrazide |
| SMILES | CC(C)(C)NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3N2O/c1-11(2,3)17-16-10(18)8-4-6-9(7-5-8)12(13,14)15/h4-7,17H,1-3H3,(H,16,18) |
| InChIKey | XDFFJXVKZIVMTL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|