C20H21F3N2O3 — CID 135065587
methyl (3S)-3-methyl-4-phenyl-3-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]butanoate (PubChem CID 135065587) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is methyl (3S)-3-methyl-4-phenyl-3-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]butanoate.
| Compound Name | methyl (3S)-3-methyl-4-phenyl-3-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]butanoate |
|---|---|
| PubChem CID | 135065587 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | methyl (3S)-3-methyl-4-phenyl-3-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]butanoate |
| SMILES | COC(=O)C[C@](C)(Cc1ccccc1)NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O3/c1-19(13-17(26)28-2,12-14-6-4-3-5-7-14)25-24-18(27)15-8-10-16(11-9-15)20(21,22)23/h3-11,25H,12-13H2,1-2H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | KJKOUKAKRUHYFF-IBGZPJMESA-N |
| XLogP | 3.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|