C19H17F3O2 — CID 177485671
methyl (E)-5-phenyl-2-[4-(trifluoromethyl)phenyl]pent-2-enoate (PubChem CID 177485671) has the molecular formula C19H17F3O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is methyl (E)-5-phenyl-2-[4-(trifluoromethyl)phenyl]pent-2-enoate.
| Compound Name | methyl (E)-5-phenyl-2-[4-(trifluoromethyl)phenyl]pent-2-enoate |
|---|---|
| PubChem CID | 177485671 |
| Molecular Formula | C19H17F3O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | methyl (E)-5-phenyl-2-[4-(trifluoromethyl)phenyl]pent-2-enoate |
| SMILES | COC(=O)/C(=C/CCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3O2/c1-24-18(23)17(9-5-8-14-6-3-2-4-7-14)15-10-12-16(13-11-15)19(20,21)22/h2-4,6-7,9-13H,5,8H2,1H3/b17-9+ |
| InChIKey | VEANERDAJNOABM-RQZCQDPDSA-N |
| XLogP | 4.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|