C29H41F3O2Sn — CID 51002967
(3-phenyl-1-tributylstannylpropyl) 4-(trifluoromethyl)benzoate (PubChem CID 51002967) has the molecular formula C29H41F3O2Sn and a molecular weight of 597.35 g/mol. Its IUPAC name is (3-phenyl-1-tributylstannylpropyl) 4-(trifluoromethyl)benzoate.
| Compound Name | (3-phenyl-1-tributylstannylpropyl) 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 51002967 |
| Molecular Formula | C29H41F3O2Sn |
| Molecular Weight | 597.35 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | (3-phenyl-1-tributylstannylpropyl) 4-(trifluoromethyl)benzoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(CCc1ccccc1)OC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3O2.3C4H9.Sn/c18-17(19,20)15-10-8-14(9-11-15)16(21)22-12-4-7-13-5-2-1-3-6-13;3*1-3-4-2;/h1-3,5-6,8-12H,4,7H2;3*1,3-4H2,2H3; |
| InChIKey | WFOQFUWQVMLTQI-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.35 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |