C30H34N2O5 — CID 142769815
[1-anilino-2-[(4-hydroxyphenyl)carbamoyl]-1-oxohexan-3-yl] 4-butylbenzoate (PubChem CID 142769815) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is [1-anilino-2-[(4-hydroxyphenyl)carbamoyl]-1-oxohexan-3-yl] 4-butylbenzoate.
| Compound Name | [1-anilino-2-[(4-hydroxyphenyl)carbamoyl]-1-oxohexan-3-yl] 4-butylbenzoate |
|---|---|
| PubChem CID | 142769815 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | [1-anilino-2-[(4-hydroxyphenyl)carbamoyl]-1-oxohexan-3-yl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC(CCC)C(C(=O)Nc2ccccc2)C(=O)Nc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C30H34N2O5/c1-3-5-10-21-13-15-22(16-14-21)30(36)37-26(9-4-2)27(28(34)31-23-11-7-6-8-12-23)29(35)32-24-17-19-25(33)20-18-24/h6-8,11-20,26-27,33H,3-5,9-10H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | PEQUTNNHSMGGLL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|