C12H9F3N2O4 — CID 123154414
4-oxo-4-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]but-2-enoic acid (PubChem CID 123154414) has the molecular formula C12H9F3N2O4 and a molecular weight of 302.21 g/mol. Its IUPAC name is 4-oxo-4-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]but-2-enoic acid.
| Compound Name | 4-oxo-4-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]but-2-enoic acid |
|---|---|
| PubChem CID | 123154414 |
| Molecular Formula | C12H9F3N2O4 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 4-oxo-4-[2-[4-(trifluoromethyl)benzoyl]hydrazinyl]but-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H9F3N2O4/c13-12(14,15)8-3-1-7(2-4-8)11(21)17-16-9(18)5-6-10(19)20/h1-6H,(H,16,18)(H,17,21)(H,19,20) |
| InChIKey | BNPVHTHNCLKSID-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|