C14H15N3O5 — CID 3374526
4-oxo-4-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoic acid (PubChem CID 3374526) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-oxo-4-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoic acid.
| Compound Name | 4-oxo-4-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoic acid |
|---|---|
| PubChem CID | 3374526 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 4-oxo-4-[2-[4-(propanoylamino)benzoyl]hydrazinyl]but-2-enoic acid |
| SMILES | CCC(=O)Nc1ccc(C(=O)NNC(=O)C=CC(=O)O)cc1 |
| InChI | InChI=1S/C14H15N3O5/c1-2-11(18)15-10-5-3-9(4-6-10)14(22)17-16-12(19)7-8-13(20)21/h3-8H,2H2,1H3,(H,15,18)(H,16,19)(H,17,22)(H,20,21) |
| InChIKey | BPJWPCPDPNVQOG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|