C17H26F3N3O3 — CID 145199288
tert-butyl N-[[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]carbamate;ethane (PubChem CID 145199288) has the molecular formula C17H26F3N3O3 and a molecular weight of 377.41 g/mol. Its IUPAC name is tert-butyl N-[[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]carbamate;ethane.
| Compound Name | tert-butyl N-[[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]carbamate;ethane |
|---|---|
| PubChem CID | 145199288 |
| Molecular Formula | C17H26F3N3O3 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | tert-butyl N-[[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl]amino]carbamate;ethane |
| SMILES | CC.CC(NNC(=O)OC(C)(C)C)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3N3O3.C2H6/c1-9(20-21-13(23)24-14(2,3)4)12(22)19-11-7-5-10(6-8-11)15(16,17)18;1-2/h5-9,20H,1-4H3,(H,19,22)(H,21,23);1-2H3 |
| InChIKey | QEOXGMQYYPEDMF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|