C13H14FN3O3 — CID 171840016
tert-butyl N-[(4-cyano-2-fluorobenzoyl)amino]carbamate (PubChem CID 171840016) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is tert-butyl N-[(4-cyano-2-fluorobenzoyl)amino]carbamate.
| Compound Name | tert-butyl N-[(4-cyano-2-fluorobenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 171840016 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | tert-butyl N-[(4-cyano-2-fluorobenzoyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)c1ccc(C#N)cc1F |
| InChI | InChI=1S/C13H14FN3O3/c1-13(2,3)20-12(19)17-16-11(18)9-5-4-8(7-15)6-10(9)14/h4-6H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | ZCAHVPUXEQMXMB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|