About 4-cyano-2-fluorobenzoyl fluoride
4-cyano-2-fluorobenzoyl fluoride (PubChem CID 11469289) has the molecular formula C8H3F2NO
and a molecular weight of 167.11 g/mol. Its IUPAC name is 4-cyano-2-fluorobenzoyl fluoride.
Molecular Properties
| Compound Name | 4-cyano-2-fluorobenzoyl fluoride |
| PubChem CID | 11469289 |
| Molecular Formula | C8H3F2NO |
| Molecular Weight | 167.11 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 4-cyano-2-fluorobenzoyl fluoride |
| SMILES | N#Cc1ccc(C(=O)F)c(F)c1 |
| InChI | InChI=1S/C8H3F2NO/c9-7-3-5(4-11)1-2-6(7)8(10)12/h1-3H |
| InChIKey | XPUZBRNQOPRWQM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.11 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-2-fluorobenzoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-2-fluorobenzoyl fluoride?
The IUPAC name of 4-cyano-2-fluorobenzoyl fluoride (CID 11469289) is 4-cyano-2-fluorobenzoyl fluoride.
What is the SMILES notation for 4-cyano-2-fluorobenzoyl fluoride?
The canonical SMILES for 4-cyano-2-fluorobenzoyl fluoride is N#Cc1ccc(C(=O)F)c(F)c1.
What is the InChIKey of 4-cyano-2-fluorobenzoyl fluoride?
The InChIKey is XPUZBRNQOPRWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F2NO/c9-7-3-5(4-11)1-2-6(7)8(10)12/h1-3H.
What are the key properties of 4-cyano-2-fluorobenzoyl fluoride?
4-cyano-2-fluorobenzoyl fluoride has a molecular weight of 167.11 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2-fluorobenzoyl fluoride is sourced from PubChem (CID 11469289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).