About tert-butyl 5-cyano-2-iodobenzoate
tert-butyl 5-cyano-2-iodobenzoate (PubChem CID 57468510) has the molecular formula C12H12INO2
and a molecular weight of 329.14 g/mol. Its IUPAC name is tert-butyl 5-cyano-2-iodobenzoate.
Molecular Properties
| Compound Name | tert-butyl 5-cyano-2-iodobenzoate |
| PubChem CID | 57468510 |
| Molecular Formula | C12H12INO2 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | tert-butyl 5-cyano-2-iodobenzoate |
| SMILES | CC(C)(C)OC(=O)c1cc(C#N)ccc1I |
| InChI | InChI=1S/C12H12INO2/c1-12(2,3)16-11(15)9-6-8(7-14)4-5-10(9)13/h4-6H,1-3H3 |
| InChIKey | SOMMGDJEGWCPLE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5-cyano-2-iodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5-cyano-2-iodobenzoate?
The IUPAC name of tert-butyl 5-cyano-2-iodobenzoate (CID 57468510) is tert-butyl 5-cyano-2-iodobenzoate.
What is the SMILES notation for tert-butyl 5-cyano-2-iodobenzoate?
The canonical SMILES for tert-butyl 5-cyano-2-iodobenzoate is CC(C)(C)OC(=O)c1cc(C#N)ccc1I.
What is the InChIKey of tert-butyl 5-cyano-2-iodobenzoate?
The InChIKey is SOMMGDJEGWCPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12INO2/c1-12(2,3)16-11(15)9-6-8(7-14)4-5-10(9)13/h4-6H,1-3H3.
What are the key properties of tert-butyl 5-cyano-2-iodobenzoate?
tert-butyl 5-cyano-2-iodobenzoate has a molecular weight of 329.14 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5-cyano-2-iodobenzoate is sourced from PubChem (CID 57468510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).