C14H17F2N3O2 — CID 115599033
tert-butyl N-[2-(4-cyano-2,6-difluoroanilino)ethyl]carbamate (PubChem CID 115599033) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is tert-butyl N-[2-(4-cyano-2,6-difluoroanilino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-cyano-2,6-difluoroanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 115599033 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | tert-butyl N-[2-(4-cyano-2,6-difluoroanilino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C14H17F2N3O2/c1-14(2,3)21-13(20)19-5-4-18-12-10(15)6-9(8-17)7-11(12)16/h6-7,18H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | ODOXWGGRAFOJCY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|