C13H16F2N2 — CID 115599015
4-(3,3-dimethylbutylamino)-3,5-difluorobenzonitrile (PubChem CID 115599015) has the molecular formula C13H16F2N2 and a molecular weight of 238.28 g/mol. Its IUPAC name is 4-(3,3-dimethylbutylamino)-3,5-difluorobenzonitrile.
| Compound Name | 4-(3,3-dimethylbutylamino)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 115599015 |
| Molecular Formula | C13H16F2N2 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4-(3,3-dimethylbutylamino)-3,5-difluorobenzonitrile |
| SMILES | CC(C)(C)CCNc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C13H16F2N2/c1-13(2,3)4-5-17-12-10(14)6-9(8-16)7-11(12)15/h6-7,17H,4-5H2,1-3H3 |
| InChIKey | IXTSPBNMBMVIBV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |