C13H13F2N5 — CID 133325276
3,5-difluoro-4-[4-(1,2,4-triazol-4-yl)butylamino]benzonitrile (PubChem CID 133325276) has the molecular formula C13H13F2N5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 3,5-difluoro-4-[4-(1,2,4-triazol-4-yl)butylamino]benzonitrile.
| Compound Name | 3,5-difluoro-4-[4-(1,2,4-triazol-4-yl)butylamino]benzonitrile |
|---|---|
| PubChem CID | 133325276 |
| Molecular Formula | C13H13F2N5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3,5-difluoro-4-[4-(1,2,4-triazol-4-yl)butylamino]benzonitrile |
| SMILES | N#Cc1cc(F)c(NCCCCn2cnnc2)c(F)c1 |
| InChI | InChI=1S/C13H13F2N5/c14-11-5-10(7-16)6-12(15)13(11)17-3-1-2-4-20-8-18-19-9-20/h5-6,8-9,17H,1-4H2 |
| InChIKey | SMKXSEOTOAGTNZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|