C18H13F3N4O — CID 133465072
3,5-difluoro-4-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]benzonitrile (PubChem CID 133465072) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is 3,5-difluoro-4-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]benzonitrile.
| Compound Name | 3,5-difluoro-4-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]benzonitrile |
|---|---|
| PubChem CID | 133465072 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3,5-difluoro-4-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]benzonitrile |
| SMILES | N#Cc1cc(F)c(NCCCc2nc(-c3ccc(F)cc3)no2)c(F)c1 |
| InChI | InChI=1S/C18H13F3N4O/c19-13-5-3-12(4-6-13)18-24-16(26-25-18)2-1-7-23-17-14(20)8-11(10-22)9-15(17)21/h3-6,8-9,23H,1-2,7H2 |
| InChIKey | GLVOTWDLUWXTRR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|