C17H14F4N4O — CID 133465033
N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)pyridin-2-amine (PubChem CID 133465033) has the molecular formula C17H14F4N4O and a molecular weight of 366.32 g/mol. Its IUPAC name is N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133465033 |
| Molecular Formula | C17H14F4N4O |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-3-(trifluoromethyl)pyridin-2-amine |
| SMILES | Fc1ccc(-c2noc(CCCNc3ncccc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H14F4N4O/c18-12-7-5-11(6-8-12)15-24-14(26-25-15)4-2-10-23-16-13(17(19,20)21)3-1-9-22-16/h1,3,5-9H,2,4,10H2,(H,22,23) |
| InChIKey | LAHDCQOPHRDQLZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|