C17H14FN5O — CID 133465110
2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]pyridine-3-carbonitrile (PubChem CID 133465110) has the molecular formula C17H14FN5O and a molecular weight of 323.33 g/mol. Its IUPAC name is 2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]pyridine-3-carbonitrile.
| Compound Name | 2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133465110 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1NCCCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H14FN5O/c18-14-7-5-12(6-8-14)17-22-15(24-23-17)4-2-10-21-16-13(11-19)3-1-9-20-16/h1,3,5-9H,2,4,10H2,(H,20,21) |
| InChIKey | FDVIUTJOTJEXPN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|