C16H13BrFN5O3 — CID 133465155
3-bromo-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-5-nitropyridin-4-amine (PubChem CID 133465155) has the molecular formula C16H13BrFN5O3 and a molecular weight of 422.21 g/mol. Its IUPAC name is 3-bromo-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-5-nitropyridin-4-amine.
| Compound Name | 3-bromo-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 133465155 |
| Molecular Formula | C16H13BrFN5O3 |
| Molecular Weight | 422.21 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 3-bromo-N-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propyl]-5-nitropyridin-4-amine |
| SMILES | O=[N+]([O-])c1cncc(Br)c1NCCCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C16H13BrFN5O3/c17-12-8-19-9-13(23(24)25)15(12)20-7-1-2-14-21-16(22-26-14)10-3-5-11(18)6-4-10/h3-6,8-9H,1-2,7H2,(H,19,20) |
| InChIKey | HPSWVJBHYAORMY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|