C15H16FN3O4S — CID 120552836
2-[2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 120552836) has the molecular formula C15H16FN3O4S and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-[2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 120552836 |
| Molecular Formula | C15H16FN3O4S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[2-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)NCCCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C15H16FN3O4S/c16-11-5-3-10(4-6-11)15-18-13(23-19-15)2-1-7-17-12(20)8-24-9-14(21)22/h3-6H,1-2,7-9H2,(H,17,20)(H,21,22) |
| InChIKey | WUUJTGVVRNEVBM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|