C9H7ClN2OS — CID 139916052
4-chloro-N-methylthieno[2,3-c]pyridine-2-carboxamide (PubChem CID 139916052) has the molecular formula C9H7ClN2OS and a molecular weight of 226.69 g/mol. Its IUPAC name is 4-chloro-N-methylthieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-methylthieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139916052 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 4-chloro-N-methylthieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc2c(Cl)cncc2s1 |
| InChI | InChI=1S/C9H7ClN2OS/c1-11-9(13)7-2-5-6(10)3-12-4-8(5)14-7/h2-4H,1H3,(H,11,13) |
| InChIKey | JUDBQGBWONKOBX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |