C15H14ClF3N2O5S3 — CID 166424955
3-[2-[(4-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166424955) has the molecular formula C15H14ClF3N2O5S3 and a molecular weight of 490.93 g/mol. Its IUPAC name is 3-[2-[(4-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[(4-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166424955 |
| Molecular Formula | C15H14ClF3N2O5S3 |
| Molecular Weight | 490.93 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | 3-[2-[(4-chlorothieno[2,3-c]pyridine-2-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)c1cc2c(Cl)cncc2s1 |
| InChI | InChI=1S/C13H13ClN2O3S3.C2HF3O2/c14-9-6-15-7-11-8(9)5-10(22-11)13(19)16-2-4-21-20-3-1-12(17)18;3-2(4,5)1(6)7/h5-7H,1-4H2,(H,16,19)(H,17,18);(H,6,7) |
| InChIKey | QQTTVQYHHGVXEM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|