C14H17F3N2O5S2 — CID 167879358
3-[2-[(5-methylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 167879358) has the molecular formula C14H17F3N2O5S2 and a molecular weight of 414.43 g/mol. Its IUPAC name is 3-[2-[(5-methylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[(5-methylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167879358 |
| Molecular Formula | C14H17F3N2O5S2 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 3-[2-[(5-methylpyridine-3-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cncc(C(=O)NCCSSCCC(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16N2O3S2.C2HF3O2/c1-9-6-10(8-13-7-9)12(17)14-3-5-19-18-4-2-11(15)16;3-2(4,5)1(6)7/h6-8H,2-5H2,1H3,(H,14,17)(H,15,16);(H,6,7) |
| InChIKey | YAYKYCUQGYXYMQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|