C16H17F3N4O5S2 — CID 166425022
3-[2-[(4-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166425022) has the molecular formula C16H17F3N4O5S2 and a molecular weight of 466.46 g/mol. Its IUPAC name is 3-[2-[(4-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[(4-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166425022 |
| Molecular Formula | C16H17F3N4O5S2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 3-[2-[(4-pyridin-4-yl-1H-pyrazole-5-carbonyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)c1[nH]ncc1-c1ccncc1 |
| InChI | InChI=1S/C14H16N4O3S2.C2HF3O2/c19-12(20)3-7-22-23-8-6-16-14(21)13-11(9-17-18-13)10-1-4-15-5-2-10;3-2(4,5)1(6)7/h1-2,4-5,9H,3,6-8H2,(H,16,21)(H,17,18)(H,19,20);(H,6,7) |
| InChIKey | UMIBRRZNDFQGJI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|