C14H15F5N2O5S2 — CID 166424852
3-[2-[[5-(difluoromethyl)pyridine-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166424852) has the molecular formula C14H15F5N2O5S2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 3-[2-[[5-(difluoromethyl)pyridine-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[5-(difluoromethyl)pyridine-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166424852 |
| Molecular Formula | C14H15F5N2O5S2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 3-[2-[[5-(difluoromethyl)pyridine-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)c1cncc(C(F)F)c1 |
| InChI | InChI=1S/C12H14F2N2O3S2.C2HF3O2/c13-11(14)8-5-9(7-15-6-8)12(19)16-2-4-21-20-3-1-10(17)18;3-2(4,5)1(6)7/h5-7,11H,1-4H2,(H,16,19)(H,17,18);(H,6,7) |
| InChIKey | RJVJMTPTRHCBOV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|