C17H19F3N4O5S2 — CID 166425095
3-[2-[[1-(4-methyl-2-pyridinyl)pyrazole-4-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166425095) has the molecular formula C17H19F3N4O5S2 and a molecular weight of 480.49 g/mol. Its IUPAC name is 3-[2-[[1-(4-methyl-2-pyridinyl)pyrazole-4-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[1-(4-methyl-2-pyridinyl)pyrazole-4-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166425095 |
| Molecular Formula | C17H19F3N4O5S2 |
| Molecular Weight | 480.49 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 3-[2-[[1-(4-methyl-2-pyridinyl)pyrazole-4-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccnc(-n2cc(C(=O)NCCSSCCC(=O)O)cn2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H18N4O3S2.C2HF3O2/c1-11-2-4-16-13(8-11)19-10-12(9-18-19)15(22)17-5-7-24-23-6-3-14(20)21;3-2(4,5)1(6)7/h2,4,8-10H,3,5-7H2,1H3,(H,17,22)(H,20,21);(H,6,7) |
| InChIKey | VGPOVGDUSGNSFV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|