C16H17F5N4O5S2 — CID 166424909
3-[2-[[5-(difluoromethyl)-1-methylpyrazolo[4,5-b]pyridine-6-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166424909) has the molecular formula C16H17F5N4O5S2 and a molecular weight of 504.46 g/mol. Its IUPAC name is 3-[2-[[5-(difluoromethyl)-1-methylpyrazolo[4,5-b]pyridine-6-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[5-(difluoromethyl)-1-methylpyrazolo[4,5-b]pyridine-6-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166424909 |
| Molecular Formula | C16H17F5N4O5S2 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 3-[2-[[5-(difluoromethyl)-1-methylpyrazolo[4,5-b]pyridine-6-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cn1ncc2nc(C(F)F)c(C(=O)NCCSSCCC(=O)O)cc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H16F2N4O3S2.C2HF3O2/c1-20-10-6-8(12(13(15)16)19-9(10)7-18-20)14(23)17-3-5-25-24-4-2-11(21)22;3-2(4,5)1(6)7/h6-7,13H,2-5H2,1H3,(H,17,23)(H,21,22);(H,6,7) |
| InChIKey | JVCIJWGZSYZPHN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|