C16H20F3NO6S2 — CID 167966827
3-[2-[(4-hydroxy-3,5-dimethylbenzoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 167966827) has the molecular formula C16H20F3NO6S2 and a molecular weight of 443.47 g/mol. Its IUPAC name is 3-[2-[(4-hydroxy-3,5-dimethylbenzoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[(4-hydroxy-3,5-dimethylbenzoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167966827 |
| Molecular Formula | C16H20F3NO6S2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 3-[2-[(4-hydroxy-3,5-dimethylbenzoyl)amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C(=O)NCCSSCCC(=O)O)cc(C)c1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19NO4S2.C2HF3O2/c1-9-7-11(8-10(2)13(9)18)14(19)15-4-6-21-20-5-3-12(16)17;3-2(4,5)1(6)7/h7-8,18H,3-6H2,1-2H3,(H,15,19)(H,16,17);(H,6,7) |
| InChIKey | RRXOZBRRVYTHNH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|