C18H19ClF3N3O5S2 — CID 166422389
3-[2-[[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166422389) has the molecular formula C18H19ClF3N3O5S2 and a molecular weight of 513.95 g/mol. Its IUPAC name is 3-[2-[[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166422389 |
| Molecular Formula | C18H19ClF3N3O5S2 |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 3-[2-[[1-(2-chlorophenyl)-5-methylpyrazole-3-carbonyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(C(=O)NCCSSCCC(=O)O)nn1-c1ccccc1Cl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H18ClN3O3S2.C2HF3O2/c1-11-10-13(19-20(11)14-5-3-2-4-12(14)17)16(23)18-7-9-25-24-8-6-15(21)22;3-2(4,5)1(6)7/h2-5,10H,6-9H2,1H3,(H,18,23)(H,21,22);(H,6,7) |
| InChIKey | REORPEZTOMAPLO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|