C21H18F3N3O2S — CID 18208505
6-methyl-4-oxo-N-(2-phenylsulfanylethyl)-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 18208505) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-(2-phenylsulfanylethyl)-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-(2-phenylsulfanylethyl)-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 18208505 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 6-methyl-4-oxo-N-(2-phenylsulfanylethyl)-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCSc2ccccc2)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O2S/c1-14-13-18(28)19(20(29)25-11-12-30-15-7-3-2-4-8-15)26-27(14)17-10-6-5-9-16(17)21(22,23)24/h2-10,13H,11-12H2,1H3,(H,25,29) |
| InChIKey | FHJAHGXRGSZWLW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|