C22H18F4N4O3 — CID 55974052
N-[2-[(2-fluorobenzoyl)amino]ethyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 55974052) has the molecular formula C22H18F4N4O3 and a molecular weight of 462.40 g/mol. Its IUPAC name is N-[2-[(2-fluorobenzoyl)amino]ethyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55974052 |
| Molecular Formula | C22H18F4N4O3 |
| Molecular Weight | 462.40 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCNC(=O)c2ccccc2F)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H18F4N4O3/c1-13-12-18(31)19(29-30(13)17-9-5-3-7-15(17)22(24,25)26)21(33)28-11-10-27-20(32)14-6-2-4-8-16(14)23/h2-9,12H,10-11H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | MABRLQRZZQVGCN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|