C20H19F3N4O4 — CID 56558876
N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 56558876) has the molecular formula C20H19F3N4O4 and a molecular weight of 436.39 g/mol. Its IUPAC name is N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 56558876 |
| Molecular Formula | C20H19F3N4O4 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | N-[3-(2,5-dioxopyrrolidin-1-yl)propyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCCCN2C(=O)CCC2=O)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O4/c1-12-11-15(28)18(19(31)24-9-4-10-26-16(29)7-8-17(26)30)25-27(12)14-6-3-2-5-13(14)20(21,22)23/h2-3,5-6,11H,4,7-10H2,1H3,(H,24,31) |
| InChIKey | BSGRUPIQTHHRQP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|