C16H16F3N3O3 — CID 78855377
N-(2-hydroxypropyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 78855377) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | N-(2-hydroxypropyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 78855377 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(2-hydroxypropyl)-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)NCC(C)O)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O3/c1-9-7-13(24)14(15(25)20-8-10(2)23)21-22(9)12-6-4-3-5-11(12)16(17,18)19/h3-7,10,23H,8H2,1-2H3,(H,20,25) |
| InChIKey | CFPRBSCLVUCBCE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |