C17H18F3N5O2S — CID 24502778
1-[[6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbonyl]amino]-3-propan-2-ylthiourea (PubChem CID 24502778) has the molecular formula C17H18F3N5O2S and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-[[6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbonyl]amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[[6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbonyl]amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 24502778 |
| Molecular Formula | C17H18F3N5O2S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-[[6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbonyl]amino]-3-propan-2-ylthiourea |
| SMILES | Cc1cc(=O)c(C(=O)NNC(=S)NC(C)C)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H18F3N5O2S/c1-9(2)21-16(28)23-22-15(27)14-13(26)8-10(3)25(24-14)12-7-5-4-6-11(12)17(18,19)20/h4-9H,1-3H3,(H,22,27)(H2,21,23,28) |
| InChIKey | ZKQJKTHCSXTYMO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|