C21H16ClF3N4O3 — CID 46656815
N'-[2-(4-chlorophenyl)acetyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbohydrazide (PubChem CID 46656815) has the molecular formula C21H16ClF3N4O3 and a molecular weight of 464.83 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbohydrazide |
|---|---|
| PubChem CID | 46656815 |
| Molecular Formula | C21H16ClF3N4O3 |
| Molecular Weight | 464.83 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-6-methyl-4-oxo-1-[2-(trifluoromethyl)phenyl]pyridazine-3-carbohydrazide |
| SMILES | Cc1cc(=O)c(C(=O)NNC(=O)Cc2ccc(Cl)cc2)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H16ClF3N4O3/c1-12-10-17(30)19(28-29(12)16-5-3-2-4-15(16)21(23,24)25)20(32)27-26-18(31)11-13-6-8-14(22)9-7-13/h2-10H,11H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | YYSKWLSFDVPXHW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.83 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|