C18H24F3NO6S2 — CID 166422633
3-[2-[[2-(2-methylpropoxy)benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 166422633) has the molecular formula C18H24F3NO6S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is 3-[2-[[2-(2-methylpropoxy)benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[[2-(2-methylpropoxy)benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166422633 |
| Molecular Formula | C18H24F3NO6S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 3-[2-[[2-(2-methylpropoxy)benzoyl]amino]ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)COc1ccccc1C(=O)NCCSSCCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23NO4S2.C2HF3O2/c1-12(2)11-21-14-6-4-3-5-13(14)16(20)17-8-10-23-22-9-7-15(18)19;3-2(4,5)1(6)7/h3-6,12H,7-11H2,1-2H3,(H,17,20)(H,18,19);(H,6,7) |
| InChIKey | KDRBFARKQWXESX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|