C16H22F3NO5 — CID 23121063
3-[[4-(2-methylpropoxy)phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 23121063) has the molecular formula C16H22F3NO5 and a molecular weight of 365.35 g/mol. Its IUPAC name is 3-[[4-(2-methylpropoxy)phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[4-(2-methylpropoxy)phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23121063 |
| Molecular Formula | C16H22F3NO5 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-[[4-(2-methylpropoxy)phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)COc1ccc(CNCCC(=O)O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21NO3.C2HF3O2/c1-11(2)10-18-13-5-3-12(4-6-13)9-15-8-7-14(16)17;3-2(4,5)1(6)7/h3-6,11,15H,7-10H2,1-2H3,(H,16,17);(H,6,7) |
| InChIKey | YRMJNWNMWGPZGD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|