C25H38N2O3 — CID 143580549
1,3-bis[[4-(2-methylpropoxy)phenyl]methyl]urea;ethane (PubChem CID 143580549) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1,3-bis[[4-(2-methylpropoxy)phenyl]methyl]urea;ethane.
| Compound Name | 1,3-bis[[4-(2-methylpropoxy)phenyl]methyl]urea;ethane |
|---|---|
| PubChem CID | 143580549 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 1,3-bis[[4-(2-methylpropoxy)phenyl]methyl]urea;ethane |
| SMILES | CC.CC(C)COc1ccc(CNC(=O)NCc2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O3.C2H6/c1-17(2)15-27-21-9-5-19(6-10-21)13-24-23(26)25-14-20-7-11-22(12-8-20)28-16-18(3)4;1-2/h5-12,17-18H,13-16H2,1-4H3,(H2,24,25,26);1-2H3 |
| InChIKey | VONHHGFHFWWHEC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |