C14H24N2O8S2 — CID 174650306
ethane-1,1-disulfonic acid;[4-(2-methylpropoxy)phenyl]methylurea (PubChem CID 174650306) has the molecular formula C14H24N2O8S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is ethane-1,1-disulfonic acid;[4-(2-methylpropoxy)phenyl]methylurea.
| Compound Name | ethane-1,1-disulfonic acid;[4-(2-methylpropoxy)phenyl]methylurea |
|---|---|
| PubChem CID | 174650306 |
| Molecular Formula | C14H24N2O8S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | ethane-1,1-disulfonic acid;[4-(2-methylpropoxy)phenyl]methylurea |
| SMILES | CC(C)COc1ccc(CNC(N)=O)cc1.CC(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C12H18N2O2.C2H6O6S2/c1-9(2)8-16-11-5-3-10(4-6-11)7-14-12(13)15;1-2(9(3,4)5)10(6,7)8/h3-6,9H,7-8H2,1-2H3,(H3,13,14,15);2H,1H3,(H,3,4,5)(H,6,7,8) |
| InChIKey | MTKAATQCZBHXSD-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|