C34H46N2O4 — CID 175674842
1,1,3-tris[[4-(2-methylpropoxy)phenyl]methyl]urea (PubChem CID 175674842) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is 1,1,3-tris[[4-(2-methylpropoxy)phenyl]methyl]urea.
| Compound Name | 1,1,3-tris[[4-(2-methylpropoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 175674842 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 1,1,3-tris[[4-(2-methylpropoxy)phenyl]methyl]urea |
| SMILES | CC(C)COc1ccc(CNC(=O)N(Cc2ccc(OCC(C)C)cc2)Cc2ccc(OCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H46N2O4/c1-25(2)22-38-31-13-7-28(8-14-31)19-35-34(37)36(20-29-9-15-32(16-10-29)39-23-26(3)4)21-30-11-17-33(18-12-30)40-24-27(5)6/h7-18,25-27H,19-24H2,1-6H3,(H,35,37) |
| InChIKey | CAYSUZZTSKUQOB-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |