C25H24F3NO6 — CID 23121224
3-[[4-[(3-phenoxyphenyl)methoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 23121224) has the molecular formula C25H24F3NO6 and a molecular weight of 491.46 g/mol. Its IUPAC name is 3-[[4-[(3-phenoxyphenyl)methoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[4-[(3-phenoxyphenyl)methoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23121224 |
| Molecular Formula | C25H24F3NO6 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[[4-[(3-phenoxyphenyl)methoxy]phenyl]methylamino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCNCc1ccc(OCc2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H23NO4.C2HF3O2/c25-23(26)13-14-24-16-18-9-11-20(12-10-18)27-17-19-5-4-8-22(15-19)28-21-6-2-1-3-7-21;3-2(4,5)1(6)7/h1-12,15,24H,13-14,16-17H2,(H,25,26);(H,6,7) |
| InChIKey | LDTPUADKUKDEFS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|