C22H20O4 — CID 163471018
2,2-dideuterio-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]propanoic acid (PubChem CID 163471018) has the molecular formula C22H20O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is 2,2-dideuterio-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]propanoic acid.
| Compound Name | 2,2-dideuterio-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 163471018 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2,2-dideuterio-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]propanoic acid |
| SMILES | [2H]C([2H])(Cc1ccc(OCc2cccc(Oc3ccccc3)c2)cc1)C(=O)O |
| InChI | InChI=1S/C22H20O4/c23-22(24)14-11-17-9-12-19(13-10-17)25-16-18-5-4-8-21(15-18)26-20-6-2-1-3-7-20/h1-10,12-13,15H,11,14,16H2,(H,23,24)/i14D2 |
| InChIKey | BWNUDKFBKGPSBH-FNHLFAINSA-N |
| XLogP | 5.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |