C24H24N2O4 — CID 70639123
4-amino-4-methylimino-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]butanoic acid (PubChem CID 70639123) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 4-amino-4-methylimino-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]butanoic acid.
| Compound Name | 4-amino-4-methylimino-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 70639123 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 4-amino-4-methylimino-3-[4-[(3-phenoxyphenyl)methoxy]phenyl]butanoic acid |
| SMILES | C/N=C(\N)C(CC(=O)O)c1ccc(OCc2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-26-24(25)22(15-23(27)28)18-10-12-19(13-11-18)29-16-17-6-5-9-21(14-17)30-20-7-3-2-4-8-20/h2-14,22H,15-16H2,1H3,(H2,25,26)(H,27,28) |
| InChIKey | RYDQVYNMHNJWGV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|