C29H44N4O3 — CID 143640878
4-amino-3-[4-[(8-ethyl-5,5-dimethyl-7,8-dihydro-6H-naphthalen-2-yl)methoxy]phenyl]-4-methyliminobutanoic acid;diazene;propane (PubChem CID 143640878) has the molecular formula C29H44N4O3 and a molecular weight of 496.70 g/mol. Its IUPAC name is 4-amino-3-[4-[(8-ethyl-5,5-dimethyl-7,8-dihydro-6H-naphthalen-2-yl)methoxy]phenyl]-4-methyliminobutanoic acid;diazene;propane.
| Compound Name | 4-amino-3-[4-[(8-ethyl-5,5-dimethyl-7,8-dihydro-6H-naphthalen-2-yl)methoxy]phenyl]-4-methyliminobutanoic acid;diazene;propane |
|---|---|
| PubChem CID | 143640878 |
| Molecular Formula | C29H44N4O3 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | 4-amino-3-[4-[(8-ethyl-5,5-dimethyl-7,8-dihydro-6H-naphthalen-2-yl)methoxy]phenyl]-4-methyliminobutanoic acid;diazene;propane |
| SMILES | CCC.CCC1CCC(C)(C)c2ccc(COc3ccc(C(CC(=O)O)/C(N)=N/C)cc3)cc21.[H]/N=N/[H] |
| InChI | InChI=1S/C26H34N2O3.C3H8.H2N2/c1-5-18-12-13-26(2,3)23-11-6-17(14-21(18)23)16-31-20-9-7-19(8-10-20)22(15-24(29)30)25(27)28-4;1-3-2;1-2/h6-11,14,18,22H,5,12-13,15-16H2,1-4H3,(H2,27,28)(H,29,30);3H2,1-2H3;1-2H/b;;2-1+ |
| InChIKey | OGOFXTJDFSJPSD-WXXKFALUSA-N |
| XLogP | 7.39 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|