C27H33NO4 — CID 143426874
3-(4,5-dihydro-1,3-oxazol-2-yl)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid (PubChem CID 143426874) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 3-(4,5-dihydro-1,3-oxazol-2-yl)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143426874 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(COc3ccc(C(CC(=O)O)C4=NCCO4)cc3)ccc21 |
| InChI | InChI=1S/C27H33NO4/c1-26(2)11-12-27(3,4)23-15-18(5-10-22(23)26)17-32-20-8-6-19(7-9-20)21(16-24(29)30)25-28-13-14-31-25/h5-10,15,21H,11-14,16-17H2,1-4H3,(H,29,30) |
| InChIKey | SAJOXYVMZFOKLN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |