C29H36N2O3 — CID 68685482
3-(1-methylimidazol-2-yl)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid (PubChem CID 68685482) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 3-(1-methylimidazol-2-yl)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-(1-methylimidazol-2-yl)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68685482 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 3-(1-methylimidazol-2-yl)-3-[4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]propanoic acid |
| SMILES | Cc1cc2c(cc1COc1ccc(C(CC(=O)O)c3nccn3C)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H36N2O3/c1-19-15-24-25(29(4,5)12-11-28(24,2)3)16-21(19)18-34-22-9-7-20(8-10-22)23(17-26(32)33)27-30-13-14-31(27)6/h7-10,13-16,23H,11-12,17-18H2,1-6H3,(H,32,33) |
| InChIKey | NTUAELDTRXNPFN-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |