About 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid
3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid (PubChem CID 68684525) has the molecular formula C24H26N2O4
and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid |
| PubChem CID | 68684525 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid |
| SMILES | Cn1ccnc1C(CC(=O)O)c1ccc(OCc2ccc3c(c2)C(C)(C)CO3)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-24(2)15-30-21-9-4-16(12-20(21)24)14-29-18-7-5-17(6-8-18)19(13-22(27)28)23-25-10-11-26(23)3/h4-12,19H,13-15H2,1-3H3,(H,27,28) |
| InChIKey | HNFKXXLELDENIK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid?
The IUPAC name of 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid (CID 68684525) is 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid.
What is the SMILES notation for 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid?
The canonical SMILES for 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid is Cn1ccnc1C(CC(=O)O)c1ccc(OCc2ccc3c(c2)C(C)(C)CO3)cc1.
What is the InChIKey of 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid?
The InChIKey is HNFKXXLELDENIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O4/c1-24(2)15-30-21-9-4-16(12-20(21)24)14-29-18-7-5-17(6-8-18)19(13-22(27)28)23-25-10-11-26(23)3/h4-12,19H,13-15H2,1-3H3,(H,27,28).
What are the key properties of 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid?
3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid has a molecular weight of 406.48 g/mol, XLogP of 4.28, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(3,3-dimethyl-2H-1-benzofuran-5-yl)methoxy]phenyl]-3-(1-methylimidazol-2-yl)propanoic acid is sourced from PubChem (CID 68684525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).