C29H38O3 — CID 59218468
(3S)-6-methyl-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]hept-5-enoic acid (PubChem CID 59218468) has the molecular formula C29H38O3 and a molecular weight of 434.62 g/mol. Its IUPAC name is (3S)-6-methyl-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]hept-5-enoic acid.
| Compound Name | (3S)-6-methyl-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59218468 |
| Molecular Formula | C29H38O3 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | (3S)-6-methyl-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methoxy]phenyl]hept-5-enoic acid |
| SMILES | CC(C)=CC[C@@H](CC(=O)O)c1ccc(OCc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C29H38O3/c1-20(2)7-9-23(18-27(30)31)22-10-12-24(13-11-22)32-19-21-8-14-25-26(17-21)29(5,6)16-15-28(25,3)4/h7-8,10-14,17,23H,9,15-16,18-19H2,1-6H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | SASUMSURCONIEU-QHCPKHFHSA-N |
| XLogP | 7.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|