C27H32O2S — CID 59218500
3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylsulfanyl]phenyl]hex-4-ynoic acid (PubChem CID 59218500) has the molecular formula C27H32O2S and a molecular weight of 420.62 g/mol. Its IUPAC name is 3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylsulfanyl]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylsulfanyl]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 59218500 |
| Molecular Formula | C27H32O2S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methylsulfanyl]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(SCc2ccc3c(c2)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C27H32O2S/c1-6-7-21(17-25(28)29)20-9-11-22(12-10-20)30-18-19-8-13-23-24(16-19)27(4,5)15-14-26(23,2)3/h8-13,16,21H,14-15,17-18H2,1-5H3,(H,28,29) |
| InChIKey | FMNDRINFVGJMSS-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|